Systematic / IUPAC Name: N-[(3R,4S,5R)-4-Hydroxy-5-(hydroxymethyl)oxolan-3-yl]acetamide
ID: Reference12002
Other Names: NAT19-554081
Formula: C7H13NO4
2-Acetamido-1,4-anhydro-2-deoxy-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 600 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/28/2022 4:48:19 PM |
| InChI | InChI=1S/C7H13NO4/c1-4(10)8-5-3-12-6(2-9)7(5)11/h5-7,9,11H,2-3H2,1H3,(H,8,10)/t5-,6-,7+/m1/s1 |
| InChI Key | DJPYWSYPQILFHU-QYNIQEEDSA-N |
| Canonical SMILES | CC(=O)NC1COC(C1O)CO |
| CAS | |
| Splash | |
| Other Names | NAT19-554081 |