Systematic / IUPAC Name: (6R)-4-(1,3-Benzothiazol-2-yl)-6-phenoxy-1,4-oxazepane
ID: Reference12007
Other Names: NAT47-553685
Formula: C18H18N2O2S
2-[(6R)-6-Phenoxy-1,4-oxazepan-4-yl]-1,3-benzothiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1178 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/28/2022 5:06:28 PM |
| InChI | InChI=1S/C18H18N2O2S/c1-2-6-14(7-3-1)22-15-12-20(10-11-21-13-15)18-19-16-8-4-5-9-17(16)23-18/h1-9,15H,10-13H2/t15-/m1/s1 |
| InChI Key | UQVMFGXCXWSWGY-OAHLLOKOSA-N |
| Canonical SMILES | C1COCC(CN1C2=NC3=CC=CC=C3S2)OC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT47-553685 |