Systematic / IUPAC Name: (2S,4S)-N-[(2R)-1-Amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-1-(2-methylsulfanylacetyl)-4-[(3-methylsulfanylphenyl)carbamoylamino]pyrrolidine-2-carboxamide
ID: Reference12011
Other Names: NAT3-155435
Formula: C27H32N6O4S2
(4S)-1-[(Methylsulfanyl)acetyl]-4-({[3-(methylsulfanyl)phenyl]carbamoyl}amino)-L-prolyl-D-tryptophanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2827 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/2/2022 8:33:37 AM |
| InChI | InChI=1S/C27H32N6O4S2/c1-38-15-24(34)33-14-18(31-27(37)30-17-6-5-7-19(11-17)39-2)12-23(33)26(36)32-22(25(28)35)10-16-13-29-21-9-4-3-8-20(16)21/h3-9,11,13,18,22-23,29H,10,12,14-15H2,1-2H3,(H2,28,35)(H,32,36)(H2,30,31,37)/t18-,22+,23-/m0/s1 |
| InChI Key | AXAXPIHMIVGZHP-NMNUPHIUSA-N |
| Canonical SMILES | CSCC(=O)N1CC(CC1C(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)N)NC(=O)NC4=CC(=CC=C4)SC |
| CAS | |
| Splash | |
| Other Names | NAT3-155435 |