Systematic / IUPAC Name: (2S)-2-[(2R)-7-Methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-(thiophen-2-ylmethyl)propanamide
ID: Reference12015
Other Names: NAT5-265129
Formula: C21H27NO2S
(2S)-2-[(2R)-7-Methoxy-5,8-dimethyl-1,2,3,4-tetrahydro-2-naphthalenyl]-N-(2-thienylmethyl)propanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1395 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/2/2022 8:39:46 AM |
| InChI | InChI=1S/C21H27NO2S/c1-13-10-20(24-4)15(3)19-11-16(7-8-18(13)19)14(2)21(23)22-12-17-6-5-9-25-17/h5-6,9-10,14,16H,7-8,11-12H2,1-4H3,(H,22,23)/t14-,16+/m0/s1 |
| InChI Key | FHJGAJDXEJUKBD-GOEBONIOSA-N |
| Canonical SMILES | CC1=CC(=C(C2=C1CCC(C2)C(C)C(=O)NCC3=CC=CS3)C)OC |
| CAS | |
| Splash | |
| Other Names | NAT5-265129 |