Systematic / IUPAC Name: N-[(2S,4S)-2-[[(2R)-1-Amino-1-oxopropan-2-yl]carbamoyl]-1-(furan-2-carbonyl)piperidin-4-yl]pyrazine-2-carboxamide
ID: Reference12041
Other Names: NAT7-242273
Formula: C19H22N6O5
N-[(2S,4S)-2-{[(2R)-1-Amino-1-oxo-2-propanyl]carbamoyl}-1-(2-furoyl)-4-piperidinyl]-2-pyrazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 990 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/10/2022 12:05:45 PM |
| InChI | InChI=1S/C19H22N6O5/c1-11(16(20)26)23-18(28)14-9-12(24-17(27)13-10-21-5-6-22-13)4-7-25(14)19(29)15-3-2-8-30-15/h2-3,5-6,8,10-12,14H,4,7,9H2,1H3,(H2,20,26)(H,23,28)(H,24,27)/t11-,12+,14+/m1/s1 |
| InChI Key | SGYXAFWAABYACT-DYEKYZERSA-N |
| Canonical SMILES | CC(C(=O)N)NC(=O)C1CC(CCN1C(=O)C2=CC=CO2)NC(=O)C3=NC=CN=C3 |
| CAS | |
| Splash | |
| Other Names | NAT7-242273 |