Systematic / IUPAC Name: N-[4-[[(6S)-6-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]phenyl]acetamide
ID: Reference12052
Other Names: NAT22-365436
Formula: C24H24N6O3
N-[4-({(6S)-6-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]-1,4,6,7-tetrahydro-5H-imidazo[4,5-c]pyridin-5-yl}methyl)phenyl]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1495 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/13/2022 11:12:04 AM |
| InChI | InChI=1S/C24H24N6O3/c1-15(31)27-18-7-3-16(4-8-18)12-30-13-21-20(25-14-26-21)11-22(30)24-28-23(29-33-24)17-5-9-19(32-2)10-6-17/h3-10,14,22H,11-13H2,1-2H3,(H,25,26)(H,27,31)/t22-/m0/s1 |
| InChI Key | NSHUPUMRIWPBTM-QFIPXVFZSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)CN2CC3=C(CC2C4=NC(=NO4)C5=CC=C(C=C5)OC)N=CN3 |
| CAS | |
| Splash | |
| Other Names | NAT22-365436 |