Systematic / IUPAC Name: 2-[(2-Acetoxybenzoyl)oxy]benzoic acid
ID: Reference1206
Other Names:
2-Carboxyphenyl o-acetylsalicylate;
Benzoic acid, 2-(acetyloxy)-, 2-carboxyphenyl ester;
2-(2-Acetyloxyphenylcarbonyloxy)benzoic acid;
2-(Acetyloxy)benzoic acid 2-carboxyphenyl ester;
2-(2-Methylcarbonyloxyphenylcarbonyloxy)benzoic acid
; more
Formula: C16H12O6
Class: Therapeutics/Prescription Drugs
Diplosal acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 73 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 3:29:30 PM |
| InChI | InChI=1S/C16H12O6/c1-10(17)21-14-9-5-3-7-12(14)16(20)22-13-8-4-2-6-11(13)15(18)19/h2-9H,1H3,(H,18,19) |
| InChI Key | DDSFKIFGAPZBSR-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)OC1=CC=CC=C1C(=O)OC2=CC=CC=C2C(=O)O |
| CAS | 530756 |
| Splash | |
| Other Names |
2-Carboxyphenyl o-acetylsalicylate; Benzoic acid, 2-(acetyloxy)-, 2-carboxyphenyl ester; 2-(2-Acetyloxyphenylcarbonyloxy)benzoic acid; 2-(Acetyloxy)benzoic acid 2-carboxyphenyl ester; 2-(2-Methylcarbonyloxyphenylcarbonyloxy)benzoic acid; 2-Hydroxybenzoic acid acetate 2-carboxyphenyl ester; Salicylacetylsalicylic acid |
| ChemSpider | 10292 |
| ChEMBL | CHEMBL350343 |
| PubChem | 10745 |
| ChemIDPlus | 000530756 |