Systematic / IUPAC Name: 4-[(2S,4S)-2-[[(2R)-1-Amino-3-methyl-1-oxobutan-2-yl]carbamoyl]-4-[(2-thiophen-2-ylacetyl)amino]piperidin-1-yl]-4-oxobutanoic acid
ID: Reference12061
Other Names: NAT7-255777
Formula: C21H30N4O6S
4-{(2S,4S)-2-{[(2R)-1-Amino-3-methyl-1-oxo-2-butanyl]carbamoyl}-4-[(2-thienylacetyl)amino]-1-piperidinyl}-4-oxobutanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1380 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/16/2022 8:43:03 AM |
| InChI | InChI=1S/C21H30N4O6S/c1-12(2)19(20(22)30)24-21(31)15-10-13(23-16(26)11-14-4-3-9-32-14)7-8-25(15)17(27)5-6-18(28)29/h3-4,9,12-13,15,19H,5-8,10-11H2,1-2H3,(H2,22,30)(H,23,26)(H,24,31)(H,28,29)/t13-,15-,19+/m0/s1 |
| InChI Key | LPJXFVSNOXPRDJ-ZUEVXXBESA-N |
| Canonical SMILES | CC(C)C(C(=O)N)NC(=O)C1CC(CCN1C(=O)CCC(=O)O)NC(=O)CC2=CC=CS2 |
| CAS | |
| Splash | |
| Other Names | NAT7-255777 |