Systematic / IUPAC Name: 2-[(3R,4S)-1-(Cyclopentanecarbonyl)-3-[2-[N-(2-morpholin-4-ylethyl)anilino]ethyl]piperidin-4-yl]acetic acid
ID: Reference12071
Other Names: NAT14-337027
Formula: C27H41N3O4
[(3R,4S)-1-(Cyclopentylcarbonyl)-3-(2-{[2-(4-morpholinyl)ethyl](phenyl)amino}ethyl)-4-piperidinyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1309 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/20/2022 9:03:03 AM |
| InChI | InChI=1S/C27H41N3O4/c31-26(32)20-23-10-13-30(27(33)22-6-4-5-7-22)21-24(23)11-12-29(25-8-2-1-3-9-25)15-14-28-16-18-34-19-17-28/h1-3,8-9,22-24H,4-7,10-21H2,(H,31,32)/t23-,24-/m0/s1 |
| InChI Key | LPQYSZUGFPPBLY-ZEQRLZLVSA-N |
| Canonical SMILES | C1CCC(C1)C(=O)N2CCC(C(C2)CCN(CCN3CCOCC3)C4=CC=CC=C4)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT14-337027 |