Systematic / IUPAC Name: (2S)-N-[(2S)-1-Amino-3-cyclohexyl-1-oxopropan-2-yl]-1-(piperidine-4-carbonyl)-4-(pyridine-3-carbonyl)piperazine-2-carboxamide
ID: Reference12075
Other Names: NAT9-312592
Formula: C26H38N6O4
(2S)-N-[(2S)-1-Amino-3-cyclohexyl-1-oxo-2-propanyl]-1-(4-piperidinylcarbonyl)-4-(3-pyridinylcarbonyl)-2-piperazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3029 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/21/2022 7:47:36 AM |
| InChI | InChI=1S/C26H38N6O4/c27-23(33)21(15-18-5-2-1-3-6-18)30-24(34)22-17-31(25(35)20-7-4-10-29-16-20)13-14-32(22)26(36)19-8-11-28-12-9-19/h4,7,10,16,18-19,21-22,28H,1-3,5-6,8-9,11-15,17H2,(H2,27,33)(H,30,34)/t21-,22-/m0/s1 |
| InChI Key | LLHWGEXHGLVXDM-VXKWHMMOSA-N |
| Canonical SMILES | C1CCC(CC1)CC(C(=O)N)NC(=O)C2CN(CCN2C(=O)C3CCNCC3)C(=O)C4=CN=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT9-312592 |