Systematic / IUPAC Name: 4-[(6S)-6-(3-Naphthalen-2-yl-1,2,4-oxadiazol-5-yl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-4-oxobutanoic acid
ID: Reference12086
Other Names: NAT22-366761
Formula: C22H19N5O4
4-{(6S)-6-[3-(2-Naphthyl)-1,2,4-oxadiazol-5-yl]-1,4,6,7-tetrahydro-5H-imidazo[4,5-c]pyridin-5-yl}-4-oxobutanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2163 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/2/2023 3:43:37 PM |
| InChI | InChI=1S/C22H19N5O4/c28-19(7-8-20(29)30)27-11-17-16(23-12-24-17)10-18(27)22-25-21(26-31-22)15-6-5-13-3-1-2-4-14(13)9-15/h1-6,9,12,18H,7-8,10-11H2,(H,23,24)(H,29,30)/t18-/m0/s1 |
| InChI Key | ILOPZQWTQBBJQG-SFHVURJKSA-N |
| Canonical SMILES | C1C(N(CC2=C1N=CN2)C(=O)CCC(=O)O)C3=NC(=NO3)C4=CC5=CC=CC=C5C=C4 |
| CAS | |
| Splash | |
| Other Names | NAT22-366761 |