Systematic / IUPAC Name: (3R,5S)-1-[(4-Methoxynaphthalen-1-yl)methyl]-5-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol
ID: Reference12096
Other Names: NAT18-348736
Formula: C25H22F3N3O4
(3R,5S)-1-[(4-Methoxy-1-naphthyl)methyl]-5-{3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl}-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 310 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/5/2023 9:19:12 AM |
| InChI | InChI=1S/C25H22F3N3O4/c1-33-22-11-8-16(19-4-2-3-5-20(19)22)13-31-14-17(32)12-21(31)24-29-23(30-35-24)15-6-9-18(10-7-15)34-25(26,27)28/h2-11,17,21,32H,12-14H2,1H3/t17-,21+/m1/s1 |
| InChI Key | QXAWURFPONFGOX-UTKZUKDTSA-N |
| Canonical SMILES | COC1=CC=C(C2=CC=CC=C21)CN3CC(CC3C4=NC(=NO4)C5=CC=C(C=C5)OC(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names | NAT18-348736 |