Systematic / IUPAC Name: 2-(4-Bromo-2,5-dimethoxyphenyl)ethanamine
ID: Reference121
Other Names:
4-Bromo-2,5-dimethoxybenzeneethanamine;
α-Desmethyl DOB;
Benzeneethanamine, 4-bromo-2,5-dimethoxy-;
Phenethylamine, 4-bromo-2,5-dimethoxy-;
1-(4-Bromo-2,5-dimethoxyphenyl)-2-ethanamine
; more
Formula: C10H14BrNO2
Class: Drugs of Abuse/Illegal Drugs
2-(4-Bromo-2,5-dimethoxyphenyl)ethylamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 364 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 10/19/2016 12:02:00 PM |
| InChI | InChI=1S/C10H14BrNO2/c1-13-9-6-8(11)10(14-2)5-7(9)3-4-12/h5-6H,3-4,12H2,1-2H3 |
| InChI Key | YMHOBZXQZVXHBM-UHFFFAOYSA-N |
| Canonical SMILES | COc1cc(c(cc1Br)OC)CCN |
| CAS | 66142812 |
| Splash | |
| Other Names |
4-Bromo-2,5-dimethoxybenzeneethanamine; α-Desmethyl DOB; Benzeneethanamine, 4-bromo-2,5-dimethoxy-; Phenethylamine, 4-bromo-2,5-dimethoxy-; 1-(4-Bromo-2,5-dimethoxyphenyl)-2-ethanamine; 2,5-Dimethoxy-4-bromophenethylamine; 4-Bromo-2,5-dimethoxyphenethylamine; 4-Bromo-2,5-dimethoxyphenylethylamine; MFT; Nexus; BDMPEA; 2C-B |
| ChemSpider | 88978; 21239470 |
| PubChem | 98527 |
| ChEMBL | CHEMBL292821 |
| Wikipedia | 2C-B |
| ChEBI | CHEBI:189669 |
| ChemIDPlus | 066142812 |