Systematic / IUPAC Name: 4-[[(1S,4S,6S)-3-Methyl-4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]morpholine
ID: Reference12103
Other Names: NAT28-412946
Formula: C24H32N4O4
4-{[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl}-2-cyclohexen-1-yl]methyl}morpholine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1716 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/12/2023 8:22:37 AM |
| InChI | InChI=1S/C24H32N4O4/c1-16(2)22-13-19(17(3)12-20(22)15-27-8-10-31-11-9-27)14-23-25-26-24(32-23)18-4-6-21(7-5-18)28(29)30/h4-7,12,16,19-20,22H,8-11,13-15H2,1-3H3/t19-,20-,22-/m0/s1 |
| InChI Key | ODRJFQNKJAOSGH-ONTIZHBOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=C(C=C3)[N+](=O)[O-])C(C)C)CN4CCOCC4 |
| CAS | |
| Splash | |
| Other Names | NAT28-412946 |