Systematic / IUPAC Name: 2-[(3R,4S)-1-Acetyl-3-[2-(diethylamino)ethyl]piperidin-4-yl]acetic acid
ID: Reference12112
Other Names: NAT14-335114
Formula: C15H28N2O3
{(3R,4S)-1-Acetyl-3-[2-(diethylamino)ethyl]-4-piperidinyl}acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1034 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/12/2023 9:13:31 AM |
| InChI | InChI=1S/C15H28N2O3/c1-4-16(5-2)8-6-14-11-17(12(3)18)9-7-13(14)10-15(19)20/h13-14H,4-11H2,1-3H3,(H,19,20)/t13-,14-/m0/s1 |
| InChI Key | GXVBKQCLQJVUFC-KBPBESRZSA-N |
| Canonical SMILES | CCN(CC)CCC1CN(CCC1CC(=O)O)C(=O)C |
| CAS | |
| Splash | |
| Other Names | NAT14-335114 |