Systematic / IUPAC Name: N-[(1S,2S,4aS,8S,8aS)-8-Hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyridine-4-carboxamide
ID: Reference12114
Other Names: NAT5-397766
Formula: C26H39N3O3
N-{(1S,2S,8S,8aS)-8-Hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-(1-piperidinyl)-2-propanyl]decahydro-2-naphthalenyl}isonicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1550 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/12/2023 9:25:21 AM |
| InChI | InChI=1S/C26H39N3O3/c1-17(25(32)29-15-5-4-6-16-29)20-7-11-26(3)12-8-21(18(2)22(26)23(20)30)28-24(31)19-9-13-27-14-10-19/h9-10,13-14,17-18,20-23,30H,4-8,11-12,15-16H2,1-3H3,(H,28,31)/t17-,18+,20?,21-,22+,23-,26-/m0/s1 |
| InChI Key | URVRORSZPYFGLD-BIUWEHEQSA-N |
| Canonical SMILES | CC1C(CCC2(C1C(C(CC2)C(C)C(=O)N3CCCCC3)O)C)NC(=O)C4=CC=NC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT5-397766 |