Systematic / IUPAC Name: N-[(1S,2S,4aS,8S,8aS)-7-[(2S)-1-[(3,5-Difluorophenyl)methylamino]-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]cyclohexanecarboxamide
ID: Reference12119
Other Names: NAT5-396829
Formula: C29H42F2N2O3
N-[(1S,2S,8S,8aS)-7-{(2S)-1-[(3,5-Difluorobenzyl)amino]-1-oxo-2-propanyl}-8-hydroxy-1,4a-dimethyldecahydro-2-naphthalenyl]cyclohexanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3145 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/12/2023 9:45:09 AM |
| InChI | InChI=1S/C29H42F2N2O3/c1-17(27(35)32-16-19-13-21(30)15-22(31)14-19)23-9-11-29(3)12-10-24(18(2)25(29)26(23)34)33-28(36)20-7-5-4-6-8-20/h13-15,17-18,20,23-26,34H,4-12,16H2,1-3H3,(H,32,35)(H,33,36)/t17-,18+,23?,24-,25+,26-,29-/m0/s1 |
| InChI Key | ORXFJFYURVROLV-ONLOYGCFSA-N |
| Canonical SMILES | CC1C(CCC2(C1C(C(CC2)C(C)C(=O)NCC3=CC(=CC(=C3)F)F)O)C)NC(=O)C4CCCCC4 |
| CAS | |
| Splash | |
| Other Names | NAT5-396829 |