Systematic / IUPAC Name: 3-[(2S,5aS,8aR)-1-Methyl-5-oxo-6-[[3-(trifluoromethoxy)phenyl]methyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-E][1,4]diazepin-2-yl]-N-(pyridin-3-ylmethyl)propanamide
ID: Reference12122
Other Names: NAT23-391025
Formula: C25H30F3N5O3
3-{(2S,5aS,8aR)-1-Methyl-5-oxo-6-[3-(trifluoromethoxy)benzyl]decahydropyrrolo[3,2-E][1,4]diazepin-2-yl}-N-(3-pyridinylmethyl)propanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2060 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/13/2023 8:30:28 AM |
| InChI | InChI=1S/C25H30F3N5O3/c1-32-19(7-8-22(34)30-14-18-5-3-10-29-13-18)15-31-24(35)23-21(32)9-11-33(23)16-17-4-2-6-20(12-17)36-25(26,27)28/h2-6,10,12-13,19,21,23H,7-9,11,14-16H2,1H3,(H,30,34)(H,31,35)/t19-,21+,23-/m0/s1 |
| InChI Key | CSTTYTZQQMRTPK-WPYKKVEZSA-N |
| Canonical SMILES | CN1C2CCN(C2C(=O)NCC1CCC(=O)NCC3=CN=CC=C3)CC4=CC(=CC=C4)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT23-391025 |