Systematic / IUPAC Name: N-[(1S,2S,4aS,8S,8aS)-7-[(2S)-1-(Furan-2-ylmethylamino)-1-oxopropan-2-yl]-8-hydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3,3-dimethylbutanamide
ID: Reference12128
Other Names: NAT5-396675
Formula: C26H42N2O4
N-[(1S,2S,8S,8aS)-7-{(2S)-1-[(2-Furylmethyl)amino]-1-oxo-2-propanyl}-8-hydroxy-1,4a-dimethyldecahydro-2-naphthalenyl]-3,3-dimethylbutanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3094 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/13/2023 8:48:11 AM |
| InChI | InChI=1S/C26H42N2O4/c1-16(24(31)27-15-18-8-7-13-32-18)19-9-11-26(6)12-10-20(17(2)22(26)23(19)30)28-21(29)14-25(3,4)5/h7-8,13,16-17,19-20,22-23,30H,9-12,14-15H2,1-6H3,(H,27,31)(H,28,29)/t16-,17+,19?,20-,22+,23-,26-/m0/s1 |
| InChI Key | GLMIPOICBAYVRZ-YCHDLCTHSA-N |
| Canonical SMILES | CC1C(CCC2(C1C(C(CC2)C(C)C(=O)NCC3=CC=CO3)O)C)NC(=O)CC(C)(C)C |
| CAS | |
| Splash | |
| Other Names | NAT5-396675 |