Systematic / IUPAC Name: N-Methyl-N-[[(1S,4S,6S)-3-methyl-6-propan-2-yl-4-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)methyl]cyclohex-2-en-1-yl]methyl]prop-2-yn-1-amine
ID: Reference12130
Other Names: NAT28-411377
Formula: C23H30N4O
N-{[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{[5-(3-pyridinyl)-1,3,4-oxadiazol-2-yl]methyl}-2-cyclohexen-1-yl]methyl}-N-methyl-2-propyn-1-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1590 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/13/2023 8:49:22 AM |
| InChI | InChI=1S/C23H30N4O/c1-6-10-27(5)15-20-11-17(4)19(12-21(20)16(2)3)13-22-25-26-23(28-22)18-8-7-9-24-14-18/h1,7-9,11,14,16,19-21H,10,12-13,15H2,2-5H3/t19-,20-,21-/m0/s1 |
| InChI Key | IVXCKRAQVMGOQV-ACRUOGEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CN=CC=C3)C(C)C)CN(C)CC#C |
| CAS | |
| Splash | |
| Other Names | NAT28-411377 |