Systematic / IUPAC Name: (2S,3S,4S,5R,6R)-3,4,5,6-Tetrahydroxyoxane-2-carboxylic acid
ID: Reference1214
Other Names:
β-D-Glucuronic acid;
D-Glucuronic acid
Formula: C6H10O7
Class: Endogenous Metabolites
β-D-Glucopyranuronic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 201 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 3:24:28 PM |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4-,6+/m0/s1 |
| InChI Key | AEMOLEFTQBMNLQ-QIUUJYRFSA-N |
| Canonical SMILES | C1(C(C(OC(C1O)O)C(=O)O)O)O |
| CAS | 6556123 |
| Splash | |
| Other Names |
β-D-Glucuronic acid; D-Glucuronic acid |
| Wikipedia | Glucuronic acid |
| ChemIDPlus | 082694733 |
| ChEBI | CHEBI:28860 |
| ChemSpider | 390202 |
| KEGG | C08350 |
| ChEMBL | CHEMBL1159524 |
| PubChem | 441478 |