Systematic / IUPAC Name: 2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-[(phenylcarbamoylamino)methyl]oxolan-2-yl]-N-[(4-fluorophenyl)methyl]acetamide
ID: Reference12149
Other Names: NAT19-353709
Formula: C21H24FN3O5
2-[(2S,3R,4S,5R)-3,4-Dihydroxy-5-{[(phenylcarbamoyl)amino]methyl}tetrahydro-2-furanyl]-N-(4-fluorobenzyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1542 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/16/2023 5:26:13 PM |
| InChI | InChI=1S/C21H24FN3O5/c22-14-8-6-13(7-9-14)11-23-18(26)10-16-19(27)20(28)17(30-16)12-24-21(29)25-15-4-2-1-3-5-15/h1-9,16-17,19-20,27-28H,10-12H2,(H,23,26)(H2,24,25,29)/t16-,17+,19-,20+/m0/s1 |
| InChI Key | GPJYVQBRTDQVGE-KVPLUYHFSA-N |
| Canonical SMILES | C1=CC=C(C=C1)NC(=O)NCC2C(C(C(O2)CC(=O)NCC3=CC=C(C=C3)F)O)O |
| CAS | |
| Splash | |
| Other Names | NAT19-353709 |