Systematic / IUPAC Name: 1,3-Diphenyl-1,3-propanedione
ID: Reference1215
Other Names:
1,3-Propanedione, 1,3-diphenyl-;
Phenyl phenacyl ketone;
ψ-Benzoylacetophenone;
Karenzu DK2
Formula: C15H12O2
Class: Extractables/Leachables Industrial Chemicals
Dibenzoylmethane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 757 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 3/16/2016 10:46:47 AM |
| InChI | InChI=1S/C15H12O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChI Key | NZZIMKJIVMHWJC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=CC=C2 |
| CAS | 120467 |
| Splash | |
| Other Names |
1,3-Propanedione, 1,3-diphenyl-; Phenyl phenacyl ketone; ψ-Benzoylacetophenone; Karenzu DK2 |
| ChemSpider | 8126 |
| Wikipedia | Dibenzoylmethane |
| ChEMBL | CHEMBL371523 |
| ChEBI | CHEBI:75417 |
| ChemIDPlus | 000120467 |
| PubChem | 8433 |