Systematic / IUPAC Name: 2-[(1S,4S,6S)-4-[2-[4-(2-Hydroxyethyl)piperazin-1-yl]-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]acetonitrile
ID: Reference12152
Other Names: NAT28-409883
Formula: C20H33N3O2
[(1S,4S,6S)-4-{2-[4-(2-Hydroxyethyl)-1-piperazinyl]-2-oxoethyl}-6-isopropyl-3-methyl-2-cyclohexen-1-yl]acetonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 890 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/20/2023 7:48:03 AM |
| InChI | InChI=1S/C20H33N3O2/c1-15(2)19-13-18(16(3)12-17(19)4-5-21)14-20(25)23-8-6-22(7-9-23)10-11-24/h12,15,17-19,24H,4,6-11,13-14H2,1-3H3/t17-,18+,19+/m1/s1 |
| InChI Key | ITEREEYPHAIAQL-QYZOEREBSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N2CCN(CC2)CCO)C(C)C)CC#N |
| CAS | |
| Splash | |
| Other Names | NAT28-409883 |
| PubChem | 38029925 |
| ChemSpider | 22937365 |
| ChEMBL | CHEMBL3437518 |