Systematic / IUPAC Name: 2-[(1S,4S,5S)-4-(Hydroxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-1-(4-methylpiperidin-1-yl)ethanone
ID: Reference12155
Other Names: NAT28-410068
Formula: C19H33NO2
2-[(1S,4S,5S)-4-(Hydroxymethyl)-5-isopropyl-2-methyl-2-cyclohexen-1-yl]-1-(4-methyl-1-piperidinyl)ethanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1430 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/20/2023 7:51:08 AM |
| InChI | InChI=1S/C19H33NO2/c1-13(2)18-10-16(15(4)9-17(18)12-21)11-19(22)20-7-5-14(3)6-8-20/h9,13-14,16-18,21H,5-8,10-12H2,1-4H3/t16-,17-,18-/m0/s1 |
| InChI Key | HSSLSKGANCWTCU-BZSNNMDCSA-N |
| Canonical SMILES | CC1CCN(CC1)C(=O)CC2CC(C(C=C2C)CO)C(C)C |
| CAS | |
| Splash | |
| Other Names | NAT28-410068 |