Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[2-(Cyclopentylamino)-2-oxoethyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]-3,3-dimethylbutanamide
ID: Reference12158
Other Names: NAT28-403271
Formula: C24H42N2O2
N-({(1S,4S,6S)-4-[2-(Cyclopentylamino)-2-oxoethyl]-6-isopropyl-3-methyl-2-cyclohexen-1-yl}methyl)-3,3-dimethylbutanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2430 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/20/2023 7:53:40 AM |
| InChI | InChI=1S/C24H42N2O2/c1-16(2)21-12-18(13-22(27)26-20-9-7-8-10-20)17(3)11-19(21)15-25-23(28)14-24(4,5)6/h11,16,18-21H,7-10,12-15H2,1-6H3,(H,25,28)(H,26,27)/t18-,19-,21-/m0/s1 |
| InChI Key | SKZMNBDUGFDSBL-ZJOUEHCJSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)NC2CCCC2)C(C)C)CNC(=O)CC(C)(C)C |
| CAS | |
| Splash | |
| Other Names | NAT28-403271 |