Systematic / IUPAC Name: 3-Phenyl-5-[(6S)-5-(thiophen-2-ylmethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-1,2,4-oxadiazole
ID: Reference12171
Other Names: NAT22-364494
Formula: C19H17N5OS
(6S)-6-(3-Phenyl-1,2,4-oxadiazol-5-yl)-5-(2-thienylmethyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 715 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2023 12:23:25 PM |
| InChI | InChI=1S/C19H17N5OS/c1-2-5-13(6-3-1)18-22-19(25-23-18)17-9-15-16(21-12-20-15)11-24(17)10-14-7-4-8-26-14/h1-8,12,17H,9-11H2,(H,20,21)/t17-/m0/s1 |
| InChI Key | DRJWNNIDLWJLTO-KRWDZBQOSA-N |
| Canonical SMILES | C1C(N(CC2=C1N=CN2)CC3=CC=CS3)C4=NC(=NO4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | NAT22-364494 |