Systematic / IUPAC Name: N-[(1S,4S)-4-(1-Benzyl-3,5-dimethylpyrazol-4-yl)cyclopent-2-en-1-yl]cyclohexanecarboxamide
ID: Reference12173
Other Names: NAT16-353282
Formula: C24H31N3O
N-[(1S,4S)-4-(1-Benzyl-3,5-dimethyl-1H-pyrazol-4-yl)-2-cyclopenten-1-yl]cyclohexanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2005 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2023 12:44:43 PM |
| InChI | InChI=1S/C24H31N3O/c1-17-23(18(2)27(26-17)16-19-9-5-3-6-10-19)21-13-14-22(15-21)25-24(28)20-11-7-4-8-12-20/h3,5-6,9-10,13-14,20-22H,4,7-8,11-12,15-16H2,1-2H3,(H,25,28)/t21-,22-/m1/s1 |
| InChI Key | KGZZIQUKHXUTJU-FGZHOGPDSA-N |
| Canonical SMILES | CC1=C(C(=NN1CC2=CC=CC=C2)C)C3CC(C=C3)NC(=O)C4CCCCC4 |
| CAS | |
| Splash | |
| Other Names | NAT16-353282 |