Systematic / IUPAC Name: 1-[(1S,4S,6S)-3-Methyl-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-6-propan-2-ylcyclohex-2-en-1-yl]-N-(pyridin-2-ylmethyl)methanamine
ID: Reference12179
Other Names: NAT28-412055
Formula: C27H34N4O
1-[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl}-2-cyclohexen-1-yl]-N-(2-pyridinylmethyl)methanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1325 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/27/2023 9:10:30 AM |
| InChI | InChI=1S/C27H34N4O/c1-18(2)25-14-22(15-26-30-31-27(32-26)21-10-8-19(3)9-11-21)20(4)13-23(25)16-28-17-24-7-5-6-12-29-24/h5-13,18,22-23,25,28H,14-17H2,1-4H3/t22-,23-,25-/m0/s1 |
| InChI Key | ZNBRGKRSUQTAJM-LSQMVHIFSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C2=NN=C(O2)CC3CC(C(C=C3C)CNCC4=CC=CC=N4)C(C)C |
| CAS | |
| Splash | |
| Other Names | NAT28-412055 |