Systematic / IUPAC Name: 2-Methoxy-N-[[(1S,4S,6S)-3-methyl-4-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]ethanamine
ID: Reference12181
Other Names: NAT28-412932
Formula: C23H32N4O4
N-{[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl}-2-cyclohexen-1-yl]methyl}-2-methoxyethanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1380 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/27/2023 9:13:42 AM |
| InChI | InChI=1S/C23H32N4O4/c1-15(2)21-12-18(16(3)11-19(21)14-24-9-10-30-4)13-22-25-26-23(31-22)17-5-7-20(8-6-17)27(28)29/h5-8,11,15,18-19,21,24H,9-10,12-14H2,1-4H3/t18-,19-,21-/m0/s1 |
| InChI Key | PUVPNARXDYRJBU-ZJOUEHCJSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=C(C=C3)[N+](=O)[O-])C(C)C)CNCCOC |
| CAS | |
| Splash | |
| Other Names | NAT28-412932 |