Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[[5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]prop-2-yn-1-amine
ID: Reference12183
Other Names: NAT28-412285
Formula: C24H31N3O2
N-{[(1S,4S,6S)-6-Isopropyl-4-{[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl}-3-methyl-2-cyclohexen-1-yl]methyl}-2-propyn-1-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1000 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/27/2023 9:17:34 AM |
| InChI | InChI=1S/C24H31N3O2/c1-6-11-25-15-20-12-17(4)19(13-22(20)16(2)3)14-23-26-27-24(29-23)18-7-9-21(28-5)10-8-18/h1,7-10,12,16,19-20,22,25H,11,13-15H2,2-5H3/t19-,20-,22-/m0/s1 |
| InChI Key | YDWRGWSVWZPQKV-ONTIZHBOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=C(C=C3)OC)C(C)C)CNCC#C |
| CAS | |
| Splash | |
| Other Names | NAT28-412285 |