Systematic / IUPAC Name: 2-[[(1S,4S,5S)-4-[[4-(2-Methoxyethyl)piperazin-1-yl]methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]methyl]-5-(4-methoxyphenyl)-1,3,4-oxadiazole
ID: Reference12186
Other Names: NAT28-412324
Formula: C28H42N4O3
1-{[(1S,4S,6S)-6-Isopropyl-4-{[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl}-3-methyl-2-cyclohexen-1-yl]methyl}-4-(2-methoxyethyl)piperazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1206 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/27/2023 9:20:33 AM |
| InChI | InChI=1S/C28H42N4O3/c1-20(2)26-17-23(18-27-29-30-28(35-27)22-6-8-25(34-5)9-7-22)21(3)16-24(26)19-32-12-10-31(11-13-32)14-15-33-4/h6-9,16,20,23-24,26H,10-15,17-19H2,1-5H3/t23-,24-,26-/m0/s1 |
| InChI Key | MYVFZKLIBIYXPG-GNKBHMEESA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=C(C=C3)OC)C(C)C)CN4CCN(CC4)CCOC |
| CAS | |
| Splash | |
| Other Names | NAT28-412324 |