Systematic / IUPAC Name: 1-[[(1S,4S,6S)-4-[[5-(2-Fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]piperidine-4-carboxamide
ID: Reference12187
Other Names: NAT28-414540
Formula: C26H35FN4O2
1-{[(1S,4S,6S)-4-{[5-(2-Fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-6-isopropyl-3-methyl-2-cyclohexen-1-yl]methyl}-4-piperidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2348 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/27/2023 9:21:27 AM |
| InChI | InChI=1S/C26H35FN4O2/c1-16(2)22-13-19(14-24-29-30-26(33-24)21-6-4-5-7-23(21)27)17(3)12-20(22)15-31-10-8-18(9-11-31)25(28)32/h4-7,12,16,18-20,22H,8-11,13-15H2,1-3H3,(H2,28,32)/t19-,20-,22-/m0/s1 |
| InChI Key | HZLWKBBXVSELAY-ONTIZHBOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=CC=C3F)C(C)C)CN4CCC(CC4)C(=O)N |
| CAS | |
| Splash | |
| Other Names | NAT28-414540 |