Systematic / IUPAC Name: 2-[(4-Fluorophenoxy)methyl]-5-[[(1S,4S,5S)-2-methyl-4-[(4-methylpiperazin-1-yl)methyl]-5-propan-2-ylcyclohex-2-en-1-yl]methyl]-1,3,4-oxadiazole
ID: Reference12188
Other Names: NAT28-413391
Formula: C26H37FN4O2
1-{[(1S,4S,6S)-4-({5-[(4-Fluorophenoxy)methyl]-1,3,4-oxadiazol-2-yl}methyl)-6-isopropyl-3-methyl-2-cyclohexen-1-yl]methyl}-4-methylpiperazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1992 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/27/2023 9:22:43 AM |
| InChI | InChI=1S/C26H37FN4O2/c1-18(2)24-14-20(19(3)13-21(24)16-31-11-9-30(4)10-12-31)15-25-28-29-26(33-25)17-32-23-7-5-22(27)6-8-23/h5-8,13,18,20-21,24H,9-12,14-17H2,1-4H3/t20-,21-,24-/m0/s1 |
| InChI Key | CFCXNSHFGNLJON-HFMPRLQTSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)COC3=CC=C(C=C3)F)C(C)C)CN4CCN(CC4)C |
| CAS | |
| Splash | |
| Other Names | NAT28-413391 |