Systematic / IUPAC Name: 4-[5-[5-[(2S)-1-(1H-Indol-3-ylmethyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-yl]morpholine
ID: Reference12195
Other Names: NAT18-432359
Formula: C24H26N6O2
3-{[(2S)-2-{3-[6-(4-Morpholinyl)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 909 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/1/2023 4:14:01 PM |
| InChI | InChI=1S/C24H26N6O2/c1-2-5-20-19(4-1)18(15-25-20)16-30-9-3-6-21(30)24-27-23(28-32-24)17-7-8-22(26-14-17)29-10-12-31-13-11-29/h1-2,4-5,7-8,14-15,21,25H,3,6,9-13,16H2/t21-/m0/s1 |
| InChI Key | AGJZLHGLMSHJHP-NRFANRHFSA-N |
| Canonical SMILES | C1CC(N(C1)CC2=CNC3=CC=CC=C32)C4=NC(=NO4)C5=CN=C(C=C5)N6CCOCC6 |
| CAS | |
| Splash | |
| Other Names | NAT18-432359 |