Systematic / IUPAC Name: 3-(6-Cyclohexyloxypyridin-3-yl)-5-[(2S)-1-[(1-methylindol-3-yl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference12196
Other Names: NAT18-432724
Formula: C27H31N5O2
3-{[(2S)-2-{3-[6-(Cyclohexyloxy)-3-pyridinyl]-1,2,4-oxadiazol-5-yl}-1-pyrrolidinyl]methyl}-1-methyl-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 445 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/1/2023 4:15:30 PM |
| InChI | InChI=1S/C27H31N5O2/c1-31-17-20(22-10-5-6-11-23(22)31)18-32-15-7-12-24(32)27-29-26(30-34-27)19-13-14-25(28-16-19)33-21-8-3-2-4-9-21/h5-6,10-11,13-14,16-17,21,24H,2-4,7-9,12,15,18H2,1H3/t24-/m0/s1 |
| InChI Key | WSDLNFRBHQMPKB-DEOSSOPVSA-N |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)CN3CCCC3C4=NC(=NO4)C5=CN=C(C=C5)OC6CCCCC6 |
| CAS | |
| Splash | |
| Other Names | NAT18-432724 |