Systematic / IUPAC Name: 2-[(3S)-1-[(2-Nitrophenyl)methyl]pyrrolidin-3-yl]-1,3-benzoxazole
ID: Reference12197
Other Names: NAT31-456941
Formula: C18H17N3O3
2-[(3S)-1-(2-Nitrobenzyl)-3-pyrrolidinyl]-1,3-benzoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 959 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/1/2023 4:17:07 PM |
| InChI | InChI=1S/C18H17N3O3/c22-21(23)16-7-3-1-5-13(16)11-20-10-9-14(12-20)18-19-15-6-2-4-8-17(15)24-18/h1-8,14H,9-12H2/t14-/m0/s1 |
| InChI Key | ZTRLJWKKWVSSMJ-AWEZNQCLSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=CC=CC=C3O2)CC4=CC=CC=C4[N+](=O)[O-] |
| CAS | |
| Splash | |
| Other Names | NAT31-456941 |