Systematic / IUPAC Name: 5-[(2S)-1-[(2-Fluorophenyl)methyl]pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazole
ID: Reference12198
Other Names: NAT18-430244
Formula: C21H23FN4O3
3-{5-[(2S)-1-(2-Fluorobenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-(2-methoxyethoxy)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 730 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/1/2023 4:18:52 PM |
| InChI | InChI=1S/C21H23FN4O3/c1-27-12-13-28-20-16(7-4-10-23-20)19-24-21(29-25-19)18-9-5-11-26(18)14-15-6-2-3-8-17(15)22/h2-4,6-8,10,18H,5,9,11-14H2,1H3/t18-/m0/s1 |
| InChI Key | MCCVQOSIGQEQAH-SFHVURJKSA-N |
| Canonical SMILES | COCCOC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=CC=CC=C4F |
| CAS | |
| Splash | |
| Other Names | NAT18-430244 |