Systematic / IUPAC Name: 5-[(6S)-5-[(4-Methoxyphenyl)methyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-pyridin-2-yl-1,2,4-oxadiazole
ID: Reference12205
Other Names: NAT22-364624
Formula: C21H20N6O2
(6S)-5-(4-Methoxybenzyl)-6-[3-(2-pyridinyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 879 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/1/2023 4:34:40 PM |
| InChI | InChI=1S/C21H20N6O2/c1-28-15-7-5-14(6-8-15)11-27-12-18-17(23-13-24-18)10-19(27)21-25-20(26-29-21)16-4-2-3-9-22-16/h2-9,13,19H,10-12H2,1H3,(H,23,24)/t19-/m0/s1 |
| InChI Key | QSPKWQQXBXJWOP-IBGZPJMESA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CN2CC3=C(CC2C4=NC(=NO4)C5=CC=CC=N5)N=CN3 |
| CAS | |
| Splash | |
| Other Names | NAT22-364624 |