Systematic / IUPAC Name: 3,4,5-Trihydroxybenzoic acid
ID: Reference1221
Other Names:
Benzoic acid, 3,4,5-trihydroxy-;
Pyrogallol-5-carboxylic acid;
5-Carboxybenzene-1,2,3-triol;
Gallic acid, 5-carboxybenzene-1,2,3-triol
Formula: C7H6O5
Class: Endogenous Metabolites
Gallic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 72 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2016 1:12:45 PM |
| InChI | InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12) |
| InChI Key | LNTHITQWFMADLM-UHFFFAOYSA-N |
| Canonical SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)O |
| CAS | 149917 |
| Splash | |
| Other Names |
Benzoic acid, 3,4,5-trihydroxy-; Pyrogallol-5-carboxylic acid; 5-Carboxybenzene-1,2,3-triol; Gallic acid, 5-carboxybenzene-1,2,3-triol |