Systematic / IUPAC Name: N-[[(1S,4S,6S)-4-[[5-(2-Fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]acetamide
ID: Reference12210
Other Names: NAT28-417631
Formula: C22H28FN3O2
N-{[(1S,4S,6S)-4-{[5-(2-Fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl}-6-isopropyl-3-methyl-2-cyclohexen-1-yl]methyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2666 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/3/2023 8:59:40 AM |
| InChI | InChI=1S/C22H28FN3O2/c1-13(2)19-10-16(14(3)9-17(19)12-24-15(4)27)11-21-25-26-22(28-21)18-7-5-6-8-20(18)23/h5-9,13,16-17,19H,10-12H2,1-4H3,(H,24,27)/t16-,17-,19-/m0/s1 |
| InChI Key | XLVYBOSLTDNJAG-LNLFQRSKSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CC=CC=C3F)C(C)C)CNC(=O)C |
| CAS | |
| Splash | |
| Other Names | NAT28-417631 |