Systematic / IUPAC Name: 5-[(2S)-1-Cyclobutylpyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazole
ID: Reference12219
Other Names: NAT18-430280
Formula: C18H24N4O3
3-{5-[(2S)-1-Cyclobutyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-(2-methoxyethoxy)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 470 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/9/2023 1:17:45 PM |
| InChI | InChI=1S/C18H24N4O3/c1-23-11-12-24-17-14(7-3-9-19-17)16-20-18(25-21-16)15-8-4-10-22(15)13-5-2-6-13/h3,7,9,13,15H,2,4-6,8,10-12H2,1H3/t15-/m0/s1 |
| InChI Key | LRBPOSHFJBNWGP-HNNXBMFYSA-N |
| Canonical SMILES | COCCOC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3C4CCC4 |
| CAS | |
| Splash | |
| Other Names | NAT18-430280 |
| ChEMBL | CHEMBL3436983 |
| PubChem | 45783431 |
| ChemSpider | 29857835 |