Systematic / IUPAC Name: (3S)-3-(6-Methyl-1H-benzimidazol-2-yl)-N-propan-2-ylpyrrolidine-1-carboxamide
ID: Reference12223
Other Names: NAT31-454395
Formula: C16H22N4O
(3S)-N-Isopropyl-3-(5-methyl-1H-benzimidazol-2-yl)-1-pyrrolidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1286 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/9/2023 1:25:49 PM |
| InChI | InChI=1S/C16H22N4O/c1-10(2)17-16(21)20-7-6-12(9-20)15-18-13-5-4-11(3)8-14(13)19-15/h4-5,8,10,12H,6-7,9H2,1-3H3,(H,17,21)(H,18,19)/t12-/m0/s1 |
| InChI Key | KJZTXUHMRHFVAD-LBPRGKRZSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=C(N2)C3CCN(C3)C(=O)NC(C)C |
| CAS | |
| Splash | |
| Other Names | NAT31-454395 |