Systematic / IUPAC Name: 2-[(3S)-1-[(3,4-Difluorophenyl)methyl]pyrrolidin-3-yl]-5-fluoro-1,3-benzoxazole
ID: Reference12224
Other Names: NAT31-458148
Formula: C18H15F3N2O
2-[(3S)-1-(3,4-Difluorobenzyl)-3-pyrrolidinyl]-5-fluoro-1,3-benzoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 840 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/9/2023 2:20:59 PM |
| InChI | InChI=1S/C18H15F3N2O/c19-13-2-4-17-16(8-13)22-18(24-17)12-5-6-23(10-12)9-11-1-3-14(20)15(21)7-11/h1-4,7-8,12H,5-6,9-10H2/t12-/m0/s1 |
| InChI Key | RYSXPHMUGNAKMZ-LBPRGKRZSA-N |
| Canonical SMILES | C1CN(CC1C2=NC3=C(O2)C=CC(=C3)F)CC4=CC(=C(C=C4)F)F |
| CAS | |
| Splash | |
| Other Names | NAT31-458148 |