Systematic / IUPAC Name: 5-[5-[(2S)-1-(3-Phenylpropyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyrimidin-4-amine
ID: Reference12227
Other Names: NAT18-473390
Formula: C19H22N6O
5-{5-[(2S)-1-(3-Phenylpropyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-4-pyrimidinamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 320 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/9/2023 8:51:11 PM |
| InChI | InChI=1S/C19H22N6O/c20-17-15(12-21-13-22-17)18-23-19(26-24-18)16-9-5-11-25(16)10-4-8-14-6-2-1-3-7-14/h1-3,6-7,12-13,16H,4-5,8-11H2,(H2,20,21,22)/t16-/m0/s1 |
| InChI Key | ZVUPITLMFKKQAT-INIZCTEOSA-N |
| Canonical SMILES | C1CC(N(C1)CCCC2=CC=CC=C2)C3=NC(=NO3)C4=CN=CN=C4N |
| CAS | |
| Splash | |
| Other Names | NAT18-473390 |
| ChemSpider | 29858209 |
| PubChem | 45783736 |
| ChEMBL | CHEMBL3436985 |