Systematic / IUPAC Name: [5-[[(2S)-2-[3-[6-(2-Methoxyethylamino)pyridin-3-yl]-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methyl]furan-2-yl]methanol
ID: Reference12251
Other Names: NAT18-432243
Formula: C20H25N5O4
(5-{[(2S)-2-(3-{6-[(2-Methoxyethyl)amino]-3-pyridinyl}-1,2,4-oxadiazol-5-yl)-1-pyrrolidinyl]methyl}-2-furyl)methanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1700 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/14/2023 9:41:29 AM |
| InChI | InChI=1S/C20H25N5O4/c1-27-10-8-21-18-7-4-14(11-22-18)19-23-20(29-24-19)17-3-2-9-25(17)12-15-5-6-16(13-26)28-15/h4-7,11,17,26H,2-3,8-10,12-13H2,1H3,(H,21,22)/t17-/m0/s1 |
| InChI Key | VAXFDNKOYKQCLN-KRWDZBQOSA-N |
| Canonical SMILES | COCCNC1=NC=C(C=C1)C2=NOC(=N2)C3CCCN3CC4=CC=C(O4)CO |
| CAS | |
| Splash | |
| Other Names | NAT18-432243 |