Systematic / IUPAC Name: Methyl (2S,4S,6S,12bR)-4-(2-fluorophenyl)-2-(2-hydroxyethylamino)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate
ID: Reference12264
Other Names: NAT15-330826
Formula: C25H28FN3O3
Methyl (2S,4S,6S,12bR)-4-(2-fluorophenyl)-2-[(2-hydroxyethyl)amino]-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2732 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/14/2023 10:53:04 AM |
| InChI | InChI=1S/C25H28FN3O3/c1-32-25(31)23-14-18-16-6-3-5-9-20(16)28-24(18)22-13-15(27-10-11-30)12-21(29(22)23)17-7-2-4-8-19(17)26/h2-9,15,21-23,27-28,30H,10-14H2,1H3/t15-,21-,22+,23-/m0/s1 |
| InChI Key | QZNFWZBAOJBDPH-FDMHNHSTSA-N |
| Canonical SMILES | COC(=O)C1CC2=C(C3N1C(CC(C3)NCCO)C4=CC=CC=C4F)NC5=CC=CC=C25 |
| CAS | |
| Splash | |
| Other Names | NAT15-330826 |