Systematic / IUPAC Name: (2S,4S)-N-[(2R)-1-Amino-1-oxo-3-phenylpropan-2-yl]-1-(2-methylsulfanylacetyl)-4-(prop-2-enylcarbamoylamino)pyrrolidine-2-carboxamide
ID: Reference12266
Other Names: NAT3-155315
Formula: C21H29N5O4S
(4S)-4-[(Allylcarbamoyl)amino]-1-[(methylsulfanyl)acetyl]-L-prolyl-D-phenylalaninamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2409 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/22/2025 9:01:33 AM |
| InChI | InChI=1S/C21H29N5O4S/c1-3-9-23-21(30)24-15-11-17(26(12-15)18(27)13-31-2)20(29)25-16(19(22)28)10-14-7-5-4-6-8-14/h3-8,15-17H,1,9-13H2,2H3,(H2,22,28)(H,25,29)(H2,23,24,30)/t15-,16+,17-/m0/s1 |
| InChI Key | QQXWEQAEWFLMJY-BBWFWOEESA-N |
| Canonical SMILES | C=CCNC(=O)N[C@H]1C[C@@H](C(=O)N[C@H](Cc2ccccc2)C(N)=O)N(C(=O)CSC)C1 |
| CAS | |
| Splash | |
| Other Names | NAT3-155315 |