Systematic / IUPAC Name: 2-[2-[(2S,4S)-2-[[(2R)-1-Amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamoyl]-4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]-2-oxoethoxy]acetic acid
ID: Reference12272
Other Names: NAT7-242312
Formula: C25H29N5O8S2
(2-{(2S,4S)-2-{[(2R)-1-Amino-3-(1H-indol-3-yl)-1-oxo-2-propanyl]carbamoyl}-4-[(2-thienylsulfonyl)amino]-1-piperidinyl}-2-oxoethoxy)acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1555 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/16/2023 4:03:58 PM |
| InChI | InChI=1S/C25H29N5O8S2/c26-24(34)19(10-15-12-27-18-5-2-1-4-17(15)18)28-25(35)20-11-16(29-40(36,37)23-6-3-9-39-23)7-8-30(20)21(31)13-38-14-22(32)33/h1-6,9,12,16,19-20,27,29H,7-8,10-11,13-14H2,(H2,26,34)(H,28,35)(H,32,33)/t16-,19+,20-/m0/s1 |
| InChI Key | PHGPKKKOKTZVBK-DBVUQKKJSA-N |
| Canonical SMILES | C1CN(C(CC1NS(=O)(=O)C2=CC=CS2)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)N)C(=O)COCC(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT7-242312 |