Systematic / IUPAC Name: Methyl (2S)-1-(cyclohexanecarbonyl)-4-(3-fluorobenzoyl)piperazine-2-carboxylate
ID: Reference12325
Other Names: NAT9-308160
Formula: C20H25FN2O4
Methyl (2S)-1-(cyclohexylcarbonyl)-4-(3-fluorobenzoyl)-2-piperazinecarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2330 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/3/2023 8:34:14 AM |
| InChI | InChI=1S/C20H25FN2O4/c1-27-20(26)17-13-22(18(24)15-8-5-9-16(21)12-15)10-11-23(17)19(25)14-6-3-2-4-7-14/h5,8-9,12,14,17H,2-4,6-7,10-11,13H2,1H3/t17-/m0/s1 |
| InChI Key | CXLXFHIRTGYPIJ-KRWDZBQOSA-N |
| Canonical SMILES | COC(=O)C1CN(CCN1C(=O)C2CCCCC2)C(=O)C3=CC(=CC=C3)F |
| CAS | |
| Splash | |
| Other Names | NAT9-308160 |